Molekula
كبريتات البوليموكسين B
Polymyxin B sulfate
مؤهل وفق ISO 9001:2015 و ISO 14001:2015 · تقديم خدمات للمختبرات والصناعة منذ عام 2000 · شهادة التحليل مع كل دفعة
Polymyxin B sulfate is a polycationic antimicrobial peptide used primarily as an antibiotic to treat severe Gram-negative bacterial infections, including those resistant to other drugs. It binds to bacterial cell membranes, disrupting their integrity. This chemical has a CAS number of 1405-20-5, with the molecular formula C55H96N16O13 · 2H2SO4 and a molecular weight of 1385.61. It must be stored between 2 to 8°C and carries a signal word of *Warning* due to its potential toxicity. Molekula supplies Polymyxin B sulfate from research to bulk quantities with full documentation and ISO 9001:2015 traceability.
نظرة عامة
Polymyxin B sulfate is a polycationic antimicrobial peptide used primarily as an antibiotic to treat severe Gram-negative bacterial infections, including those resistant to other drugs. It binds to bacterial cell membranes, disrupting their integrity. This chemical has a CAS number of 1405-20-5, with the molecular formula C55H96N16O13 · 2H2SO4 and a molecular weight of 1385.61. It must be stored between 2 to 8°C and carries a signal word of *Warning* due to its potential toxicity. Molekula supplies Polymyxin B sulfate from research to bulk quantities with full documentation and ISO 9001:2015 traceability.
الأسعار ومقاسات التعبئة
المواصفات
| Property | Value |
|---|---|
| Appearance | White to off-white powder |
| Conclusion | Conforms to USP35 |
| Heavy metals | ≤20ppm |
| Identification | Liquid chromatography: conforms |
| pH | 5 - 7 |
| Loss on Drying | ≤6% |
| Solubility | Freely soluble in water, slightly soluble in Ethanol |
| Sulphated Ash | ≤0.75% |
| Particle Size | ≤30µm |
| Specific optical rotation | -78° - -90° |
| Phenylalanine | 9.0%-12.0% |
| Pyrogens | Meets the requirements |
| Total viable aerobic count | ≤100cfu/g |
| Potency (Dry Basis) | ≥ 6500 IU/mg |
| Sulphates (SO4)(2-) | 15.5% - 17.5% |
التخزين والتعامل
| Property | Value |
|---|---|
| درجة حرارة التخزين | 2 to 8 °C |
| الحموضة | Neutral |
التعرف
| Property | Value |
|---|---|
| SKU | 59662126 |
| رقم CAS | 1405-20-5 |
| الصيغة الجزيئية | C55H96N16O13 · 2H2SO4 |
| الوزن الجزيئي | 1385.61 |
| SMILES | CCC(C)CCCCC(=O)NC(CCN)C(=O)NC(C(C)O)C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CCN)CC2=CC=CC=C2)CC(C)C)CCN)CCN)C(C)O.OS(=O)(=O)O |
| رمز REACH | Y113 |
| رقم التعريف الجمركي | 29419000 |
السلامة ونظام التصنيف والتحذير العالمي
-
Health Hazard
GHS07
بيانات الخطر
- H302 ضار إذا ابتلع
- H317 قد يسبب تفاعلاً للحساسية في الجلد
- H319 يسبب تهيجاً شديداً للعين
- H332 يسبب ضرراً إذا استنشق
- H336 قد يسبب النعاس أو الترنح
إقرارات احترازية
- P261 تجنب تنفس الغبار / الدخان / الغاز / الضباب / الأبخرة / الرذاذ
- P280 توضع قفازات للحماية / ملابس للحماية / وقاء للعينين / للوجه
- P301+312 إذا تم ابتلاعه: استعن بمركز سُمّ أو طبيب/طبيب مُقيّم إذا شعرت بالسوء
- P302+352 إذا وقع على الجلد: اغسل بالصابون والماء
- P304+341 إذا تم استنشاقه: إذا كانت هناك صعوبة في التنفس، يُنقل المصاب إلى مكان به هواء نقي ويُوضع في وضع مريح للتنفس
- P305+351+338 إذا وقعت في العينين: اغسل بالماء لمدة عدة دقائق. ازل العدسات اللاصقة إذا كانت موجودة وسهل إزالتها. واصل الغسل
الوثائق
أوراق بيانات السلامة (SDS)
متوفر بـ English, French, German, Italian, Spanish.
شهادة التحليل (CoA) حسب الدفعة
أدخل رقم الدفعة أو الحزمة للحصول على شهادة المطابقة الخاصة بهذه الدفعة المحددة. يمكننا إنشاء واحدة من بيانات المواصفات إذا لم تكن هناك نسخة PDF محفوظة.
مرادفات
لا توجد أسماء بديلة مسجلة لهذا المنتج.
الأسئلة الشائعة
What is Polymyxin B sulfate commonly used for?
Polymyxin B sulfate is primarily used as an antibiotic to treat Gram-negative bacterial infections, including those caused by *Pseudomonas aeruginosa* and *Escherichia coli*.
What is the chemical formula and molecular weight of Polymyxin B sulfate?
The chemical formula is **C55H96N16O13 · 2H2SO4**, and the molecular weight is **1385.61 g/mol**.
How should Polymyxin B sulfate be stored?
Store at **2 to 8°C** to maintain stability and potency.
What grades or purities of Polymyxin B sulfate does Molekula supply?
Molekula supplies **pharmaceutical-grade Polymyxin B sulfate** suitable for research and clinical applications.
Can Molekula supply Polymyxin B sulfate in bulk quantities?
Yes, Molekula can provide Polymyxin B sulfate in bulk, with quantities tailored to your requirements.
What documentation comes with an order of Polymyxin B sulfate?
Each order includes a **Certificate of Analysis (CoA)**, **Material Safety Data Sheet (MSDS)**, and **batch-specific documentation** for traceability.
جاهز للطلب أو تحتاج إلى حزمة مخصصة؟
أخبرنا بالمنتج، والجودة، والكمية — عادةً ما نرد خلال يوم عمل واحد بأسعار التوريد وموعد التسليم.