Molekula
ديسفيريوكسامين B ميسيلات
Desferrioxamine B mesylate
مؤهل وفق ISO 9001:2015 و ISO 14001:2015 · تقديم خدمات للمختبرات والصناعة منذ عام 2000 · شهادة التحليل مع كل دفعة
Desferrioxamine B mesylate is a potent iron-chelating agent primarily used in the treatment of iron overload, such as in thalassemia and other chronic blood transfusion conditions. It binds excess iron, facilitating its excretion. This product has a CAS number of 138-14-7, a molecular formula of C25H48N6O8·CH4O3S, and a molecular weight of 656.79. It must be stored at -15 to -20°C and carries no signal word. Molekula supplies Desferrioxamine B mesylate from research to bulk quantities with full documentation and ISO 9001:2015 traceability.
نظرة عامة
Desferrioxamine B mesylate is a potent iron-chelating agent primarily used in the treatment of iron overload, such as in thalassemia and other chronic blood transfusion conditions. It binds excess iron, facilitating its excretion. This product has a CAS number of 138-14-7, a molecular formula of C25H48N6O8·CH4O3S, and a molecular weight of 656.79. It must be stored at -15 to -20°C and carries no signal word. Molekula supplies Desferrioxamine B mesylate from research to bulk quantities with full documentation and ISO 9001:2015 traceability.
الأسعار ومقاسات التعبئة
المواصفات
| Property | Value |
|---|---|
| Appearance | White to Off-white powder |
| Water | ≤ 0.5% |
| Purity (HPLC) | ⩾ 98.0% |
| Identification (IR) | Conforms to Reference |
التخزين والتعامل
| Property | Value |
|---|---|
| درجة حرارة التخزين | -15 to -20 °C |
| الحموضة | Neutral |
التعرف
| Property | Value |
|---|---|
| SKU | 13494349 |
| رقم CAS | 138-14-7 |
| الصيغة الجزيئية | C25H48N6O8.CH4O3S |
| الوزن الجزيئي | 656.79 |
| SMILES | CC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCN)O)O)O.CS(=O)(=O)O |
| رمز REACH | Y113 |
| رقم HTS | 29280050 |
| رقم التعريف الجمركي | 2928009090 |
السلامة ونظام التصنيف والتحذير العالمي
إقرارات احترازية
- P280 توضع قفازات للحماية / ملابس للحماية / وقاء للعينين / للوجه
الوثائق
أوراق بيانات السلامة (SDS)
متوفر بـ English, French, German, Italian, Portuguese, Russian, Spanish.
شهادة التحليل (CoA) حسب الدفعة
أدخل رقم الدفعة أو الحزمة للحصول على شهادة المطابقة الخاصة بهذه الدفعة المحددة. يمكننا إنشاء واحدة من بيانات المواصفات إذا لم تكن هناك نسخة PDF محفوظة.
مرادفات
لا توجد أسماء بديلة مسجلة لهذا المنتج.
الأسئلة الشائعة
What is Desferrioxamine B mesylate used for?
Desferrioxamine B mesylate is primarily used as an iron-chelating agent for the treatment of iron overload disorders, such as thalassemia.
What is the chemical formula and molecular weight of Desferrioxamine B mesylate?
The chemical formula is **C25H48N6O8·CH4O3S**, and the molecular weight is **656.79 g/mol**.
How should Desferrioxamine B mesylate be stored?
It should be stored at **-15 to -20°C** to maintain stability and potency.
What grades or purity levels of Desferrioxamine B mesylate does Molekula supply?
Molekula supplies **pharmaceutical-grade (USP/EP/BP compliant)** Desferrioxamine B mesylate.
Can Molekula supply Desferrioxamine B mesylate in bulk quantities?
Yes, Molekula can provide bulk quantities of Desferrioxamine B mesylate upon request, subject to availability and regulatory compliance.
What documentation comes with an order of Desferrioxamine B mesylate?
Each order includes a **Certificate of Analysis (CoA)**, **Material Safety Data Sheet (MSDS)**, and **batch-specific documentation** for traceability.
جاهز للطلب أو تحتاج إلى حزمة مخصصة؟
أخبرنا بالمنتج، والجودة، والكمية — عادةً ما نرد خلال يوم عمل واحد بأسعار التوريد وموعد التسليم.