Molekula
كرومازورول ب
Chromeazurol B is a chromogenic reagent used in analytical chemistry for the detection and quantification of metal ions, particularly aluminum and iron. It functions as a colorimetric indicator in complexometric titrations. Available with a CAS number of 1796-92-5, its molecular formula is C23H14Cl2Na2O6 and molecular weight is 503.24 g/mol. It is stable at ambient storage conditions and has no signal word. Molekula supplies Chromeazurol B from research to bulk quantities with full documentation and ISO 9001:2015 traceability.
نظرة عامة
Chromeazurol B is a chromogenic reagent used in analytical chemistry for the detection and quantification of metal ions, particularly aluminum and iron. It functions as a colorimetric indicator in complexometric titrations. Available with a CAS number of 1796-92-5, its molecular formula is C23H14Cl2Na2O6 and molecular weight is 503.24 g/mol. It is stable at ambient storage conditions and has no signal word. Molekula supplies Chromeazurol B from research to bulk quantities with full documentation and ISO 9001:2015 traceability.
المواصفات
| Property | Value |
|---|---|
| Appearance | brown powder |
| Assay | 98%-102% |
| Moisture | ≤5% |
| Water insoluble matter | ≤0.5% |
| Fineness degree(by 80 mesh sieve residue) | ≤5% |
التخزين والتعامل
| Property | Value |
|---|---|
| Storage Temperature | Ambient |
| Shelf Life | 24 months |
| Acidity | Neutral |
التعرف
| Property | Value |
|---|---|
| CAS Number | 1796-92-5 |
| Molecular Formula | C23H14Cl2Na2O6 |
| Molecular Weight | 503.24 |
| SMILES | CC1=CC(=CC(=C1[O-])C(=O)[O-])C(=C2C=C(C(=O)C(=C2)C(=O)O)C)C3=C(C=CC=C3Cl)Cl.[Na+].[Na+] |
| REACH Code | Y113 |
| TSCA Listed | Yes |
| HTS Code | 2918303000 |
| Tariff Code | 2918999090 |
السلامة ونظام التصنيف والتحذير العالمي
إقرارات احترازية
- P280 Wear protective gloves/protective clothing/eye protection/face protection
مخصص للأغراض البحثية والصناعية فقط
الوثائق
شهادة التحليل (CoA) حسب الدفعة
أدخل رقم الدفعة أو الحزمة للحصول على شهادة المطابقة الخاصة بهذه الدفعة المحددة. يمكننا إنشاء واحدة من بيانات المواصفات إذا لم تكن هناك نسخة PDF محفوظة.
الأسعار ومقاسات التعبئة
مرادفات
لا توجد أسماء بديلة مسجلة لهذا المنتج.
الأسئلة الشائعة
What is Chromeazurol B used for?
Chromeazurol B is primarily used as a chromogenic reagent in analytical chemistry for the detection and quantification of metal ions, particularly aluminum and iron.
What is the chemical formula and molecular weight of Chromeazurol B?
The formula is C23H14Cl2Na2O6 with a molecular weight of 503.24 g/mol.
How should Chromeazurol B be stored?
It should be stored at ambient temperature, protected from moisture and light.
What grade of Chromeazurol B is available?
Molekula supplies Chromeazurol B in analytical grade.
Can Molekula supply Chromeazurol B in bulk?
Yes, Molekula can supply Chromeazurol B in bulk quantities upon request.
What documentation comes with a Chromeazurol B order?
Each order includes a Certificate of Analysis and Safety Data Sheet (SDS).
جاهز للطلب أو تحتاج إلى حزمة مخصصة؟
أخبرنا بالمنتج، والجودة، والكمية — عادةً ما نرد خلال يوم عمل واحد بأسعار التوريد وموعد التسليم.